C28H20Cl2F3N3O4S2 — CID 19250336
2-[(9S)-9-(2,3-dichlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 19250336) has the molecular formula C28H20Cl2F3N3O4S2 and a molecular weight of 654.52 g/mol. Its IUPAC name is 2-[(9S)-9-(2,3-dichlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(9S)-9-(2,3-dichlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 19250336 |
| Molecular Formula | C28H20Cl2F3N3O4S2 |
| Molecular Weight | 654.52 g/mol |
| Exact Mass | 653.02 |
| IUPAC Name | 2-[(9S)-9-(2,3-dichlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(Cl)c2Cl)c2sc(=O)[nH]c2SC31)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H20Cl2F3N3O4S2/c29-14-6-3-4-10(21(14)30)17-18-11-8-12(22(18)41-24-23(17)42-27(40)35-24)20-19(11)25(38)36(26(20)39)9-16(37)34-15-7-2-1-5-13(15)28(31,32)33/h1-7,11-12,17-20,22H,8-9H2,(H,34,37)(H,35,40) |
| InChIKey | NFMSZLHJZIOTFC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|