C27H21F3N4O4S2 — CID 19250332
N-[2-(trifluoromethyl)phenyl]-2-[(9S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide (PubChem CID 19250332) has the molecular formula C27H21F3N4O4S2 and a molecular weight of 586.62 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)phenyl]-2-[(9S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide.
| Compound Name | N-[2-(trifluoromethyl)phenyl]-2-[(9S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide |
|---|---|
| PubChem CID | 19250332 |
| Molecular Formula | C27H21F3N4O4S2 |
| Molecular Weight | 586.62 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | N-[2-(trifluoromethyl)phenyl]-2-[(9S)-6,13,15-trioxo-9-pyridin-3-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide |
| SMILES | O=C(CN1C(=O)C2C3CC(C2C1=O)C1C(c2cccnc2)c2sc(=O)[nH]c2SC31)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H21F3N4O4S2/c28-27(29,30)14-5-1-2-6-15(14)32-16(35)10-34-24(36)19-12-8-13(20(19)25(34)37)21-18(12)17(11-4-3-7-31-9-11)22-23(39-21)33-26(38)40-22/h1-7,9,12-13,17-21H,8,10H2,(H,32,35)(H,33,38) |
| InChIKey | OFZYWHUTEGFSOO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.62 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|