C27H22ClN3O4S2 — CID 16557856
2-[9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide (PubChem CID 16557856) has the molecular formula C27H22ClN3O4S2 and a molecular weight of 552.08 g/mol. Its IUPAC name is 2-[9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide.
| Compound Name | 2-[9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 16557856 |
| Molecular Formula | C27H22ClN3O4S2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 2-[9-(4-chlorophenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide |
| SMILES | O=C(CN1C(=O)C2C3CC(C2C1=O)C1C(c2ccc(Cl)cc2)c2sc(=O)[nH]c2SC31)Nc1ccccc1 |
| InChI | InChI=1S/C27H22ClN3O4S2/c28-13-8-6-12(7-9-13)18-19-15-10-16(22(19)36-24-23(18)37-27(35)30-24)21-20(15)25(33)31(26(21)34)11-17(32)29-14-4-2-1-3-5-14/h1-9,15-16,18-22H,10-11H2,(H,29,32)(H,30,35) |
| InChIKey | ZDSSPWUUAIJIIS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|