C35H34N4O4S2 — CID 19250417
2-[(9S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-naphthalen-1-ylacetamide (PubChem CID 19250417) has the molecular formula C35H34N4O4S2 and a molecular weight of 638.82 g/mol. Its IUPAC name is 2-[(9S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-naphthalen-1-ylacetamide.
| Compound Name | 2-[(9S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 19250417 |
| Molecular Formula | C35H34N4O4S2 |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 2-[(9S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-naphthalen-1-ylacetamide |
| SMILES | CCN(CC)c1ccc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CC(=O)Nc6cccc7ccccc67)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C35H34N4O4S2/c1-3-38(4-2)20-14-12-19(13-15-20)26-27-22-16-23(30(27)44-32-31(26)45-35(43)37-32)29-28(22)33(41)39(34(29)42)17-25(40)36-24-11-7-9-18-8-5-6-10-21(18)24/h5-15,22-23,26-30H,3-4,16-17H2,1-2H3,(H,36,40)(H,37,43) |
| InChIKey | AHDROORMMIXLQI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|