C30H31N3O4S2 — CID 78579405
(9S)-9-[4-(diethylamino)phenyl]-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 78579405) has the molecular formula C30H31N3O4S2 and a molecular weight of 561.73 g/mol. Its IUPAC name is (9S)-9-[4-(diethylamino)phenyl]-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (9S)-9-[4-(diethylamino)phenyl]-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 78579405 |
| Molecular Formula | C30H31N3O4S2 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (9S)-9-[4-(diethylamino)phenyl]-14-(4-methoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | CCN(CC)c1ccc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(OC)cc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C30H31N3O4S2/c1-4-32(5-2)16-8-6-15(7-9-16)21-22-19-14-20(25(22)38-27-26(21)39-30(36)31-27)24-23(19)28(34)33(29(24)35)17-10-12-18(37-3)13-11-17/h6-13,19-25H,4-5,14H2,1-3H3,(H,31,36) |
| InChIKey | PUTRLJFPYKHXAA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 82.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|