C29H29N3O3S2 — CID 43849616
(1R,11S)-9-[4-(diethylamino)phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43849616) has the molecular formula C29H29N3O3S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is (1R,11S)-9-[4-(diethylamino)phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,11S)-9-[4-(diethylamino)phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43849616 |
| Molecular Formula | C29H29N3O3S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.17 |
| IUPAC Name | (1R,11S)-9-[4-(diethylamino)phenyl]-14-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | CCN(CC)c1ccc(C2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4ccccc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C29H29N3O3S2/c1-3-31(4-2)16-12-10-15(11-13-16)20-21-18-14-19(24(21)36-26-25(20)37-29(35)30-26)23-22(18)27(33)32(28(23)34)17-8-6-5-7-9-17/h5-13,18-24H,3-4,14H2,1-2H3,(H,30,35)/t18-,19-,20?,21?,22?,23?,24?/m1/s1 |
| InChIKey | XLFRFOOTUNJTQP-GVRAKVGESA-N |
| XLogP | 4.96 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|