C32H33N3O5S2 — CID 43849408
ethyl 4-[(1R,11S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 43849408) has the molecular formula C32H33N3O5S2 and a molecular weight of 603.77 g/mol. Its IUPAC name is ethyl 4-[(1R,11S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(1R,11S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 43849408 |
| Molecular Formula | C32H33N3O5S2 |
| Molecular Weight | 603.77 g/mol |
| Exact Mass | 603.19 |
| IUPAC Name | ethyl 4-[(1R,11S)-9-[4-(diethylamino)phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@@H]2C[C@H]3C3Sc4[nH]c(=O)sc4C(c4ccc(N(CC)CC)cc4)C32)cc1 |
| InChI | InChI=1S/C32H33N3O5S2/c1-4-34(5-2)18-11-7-16(8-12-18)22-23-20-15-21(26(23)41-28-27(22)42-32(39)33-28)25-24(20)29(36)35(30(25)37)19-13-9-17(10-14-19)31(38)40-6-3/h7-14,20-26H,4-6,15H2,1-3H3,(H,33,39)/t20-,21-,22?,23?,24?,25?,26?/m1/s1 |
| InChIKey | LWDWQIZXFWLORR-MAFKLOINSA-N |
| XLogP | 5.14 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|