C36H32N2O7S2 — CID 43849370
ethyl 4-[(1R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 43849370) has the molecular formula C36H32N2O7S2 and a molecular weight of 668.79 g/mol. Its IUPAC name is ethyl 4-[(1R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(1R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 43849370 |
| Molecular Formula | C36H32N2O7S2 |
| Molecular Weight | 668.79 g/mol |
| Exact Mass | 668.17 |
| IUPAC Name | ethyl 4-[(1R,11S)-9-(3-methoxy-4-phenylmethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@@H]2C[C@H]3C3Sc4[nH]c(=O)sc4C(c4ccc(OCc5ccccc5)c(OC)c4)C32)cc1 |
| InChI | InChI=1S/C36H32N2O7S2/c1-3-44-35(41)19-9-12-21(13-10-19)38-33(39)28-22-16-23(29(28)34(38)40)30-27(22)26(31-32(46-30)37-36(42)47-31)20-11-14-24(25(15-20)43-2)45-17-18-7-5-4-6-8-18/h4-15,22-23,26-30H,3,16-17H2,1-2H3,(H,37,42)/t22-,23-,26?,27?,28?,29?,30?/m1/s1 |
| InChIKey | IVHKWRWZXMELJW-LSKBHTDXSA-N |
| XLogP | 5.88 |
| TPSA | 115.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.79 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|