C32H32N2O5S2 — CID 78579340
ethyl 4-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78579340) has the molecular formula C32H32N2O5S2 and a molecular weight of 588.75 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78579340 |
| Molecular Formula | C32H32N2O5S2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | ethyl 4-[(9S)-9-(4-tert-butylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3ccc(C(C)(C)C)cc3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C32H32N2O5S2/c1-5-39-30(37)16-8-12-18(13-9-16)34-28(35)23-19-14-20(24(23)29(34)36)25-22(19)21(26-27(40-25)33-31(38)41-26)15-6-10-17(11-7-15)32(2,3)4/h6-13,19-25H,5,14H2,1-4H3,(H,33,38) |
| InChIKey | FASPOUACFAHGCK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|