C28H25N3O4S2 — CID 98176498
N-(3-methylphenyl)-2-[(1S,2R,9R,10S,11R,12R,16R)-6,13,15-trioxo-9-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide (PubChem CID 98176498) has the molecular formula C28H25N3O4S2 and a molecular weight of 531.66 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[(1S,2R,9R,10S,11R,12R,16R)-6,13,15-trioxo-9-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide.
| Compound Name | N-(3-methylphenyl)-2-[(1S,2R,9R,10S,11R,12R,16R)-6,13,15-trioxo-9-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide |
|---|---|
| PubChem CID | 98176498 |
| Molecular Formula | C28H25N3O4S2 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.13 |
| IUPAC Name | N-(3-methylphenyl)-2-[(1S,2R,9R,10S,11R,12R,16R)-6,13,15-trioxo-9-phenyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)[C@@H]3[C@H]4C[C@H]([C@H]5Sc6[nH]c(=O)sc6[C@@H](c6ccccc6)[C@H]45)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C28H25N3O4S2/c1-13-6-5-9-15(10-13)29-18(32)12-31-26(33)21-16-11-17(22(21)27(31)34)23-20(16)19(14-7-3-2-4-8-14)24-25(36-23)30-28(35)37-24/h2-10,16-17,19-23H,11-12H2,1H3,(H,29,32)(H,30,35)/t16-,17-,19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | GHMPUMBMUZARQV-UJDBKOHPSA-N |
| XLogP | 3.86 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|