C24H25N3O4S2 — CID 98176463
2-[(1S,2R,10S,11S,12R,16R)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(3-methylphenyl)acetamide (PubChem CID 98176463) has the molecular formula C24H25N3O4S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 2-[(1S,2R,10S,11S,12R,16R)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(1S,2R,10S,11S,12R,16R)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 98176463 |
| Molecular Formula | C24H25N3O4S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 2-[(1S,2R,10S,11S,12R,16R)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)[C@@H]3[C@@H]4C[C@H]([C@H]5Sc6[nH]c(=O)sc6C(C)(C)[C@H]45)[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C24H25N3O4S2/c1-10-5-4-6-11(7-10)25-14(28)9-27-21(29)15-12-8-13(16(15)22(27)30)18-17(12)24(2,3)19-20(32-18)26-23(31)33-19/h4-7,12-13,15-18H,8-9H2,1-3H3,(H,25,28)(H,26,31)/t12-,13-,15+,16-,17+,18+/m0/s1 |
| InChIKey | BDISPWOVMPBCEX-ZGOPYKFNSA-N |
| XLogP | 3.00 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|