C23H22ClN3O4S2 — CID 19251199
N-(4-chlorophenyl)-2-(9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetamide (PubChem CID 19251199) has the molecular formula C23H22ClN3O4S2 and a molecular weight of 504.03 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetamide |
|---|---|
| PubChem CID | 19251199 |
| Molecular Formula | C23H22ClN3O4S2 |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.07 |
| IUPAC Name | N-(4-chlorophenyl)-2-(9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetamide |
| SMILES | CC1(C)c2sc(=O)[nH]c2SC2C3CC(C4C(=O)N(CC(=O)Nc5ccc(Cl)cc5)C(=O)C34)C21 |
| InChI | InChI=1S/C23H22ClN3O4S2/c1-23(2)16-11-7-12(17(16)32-19-18(23)33-22(31)26-19)15-14(11)20(29)27(21(15)30)8-13(28)25-10-5-3-9(24)4-6-10/h3-6,11-12,14-17H,7-8H2,1-2H3,(H,25,28)(H,26,31) |
| InChIKey | DKFGAYHDYXEGOX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|