C26H27N3O6S2 — CID 124764577
ethyl 4-[[2-[(1R,2R,10R,11S,12S,16S)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate (PubChem CID 124764577) has the molecular formula C26H27N3O6S2 and a molecular weight of 541.65 g/mol. Its IUPAC name is ethyl 4-[[2-[(1R,2R,10R,11S,12S,16S)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(1R,2R,10R,11S,12S,16S)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 124764577 |
| Molecular Formula | C26H27N3O6S2 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.13 |
| IUPAC Name | ethyl 4-[[2-[(1R,2R,10R,11S,12S,16S)-9,9-dimethyl-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CN2C(=O)[C@@H]3[C@H]4C[C@@H]([C@@H]3C2=O)[C@H]2[C@@H]4Sc3[nH]c(=O)sc3C2(C)C)cc1 |
| InChI | InChI=1S/C26H27N3O6S2/c1-4-35-24(33)11-5-7-12(8-6-11)27-15(30)10-29-22(31)16-13-9-14(17(16)23(29)32)19-18(13)26(2,3)20-21(36-19)28-25(34)37-20/h5-8,13-14,16-19H,4,9-10H2,1-3H3,(H,27,30)(H,28,34)/t13-,14+,16-,17+,18-,19+/m0/s1 |
| InChIKey | CPTVKKABNVQKSK-SFGZTYNLSA-N |
| XLogP | 2.87 |
| TPSA | 125.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|