C21H19FN2O3S2 — CID 98185922
(1S,2R,10R,11S,12R,16S)-14-(4-fluorophenyl)-9,9-dimethyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 98185922) has the molecular formula C21H19FN2O3S2 and a molecular weight of 430.53 g/mol. Its IUPAC name is (1S,2R,10R,11S,12R,16S)-14-(4-fluorophenyl)-9,9-dimethyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1S,2R,10R,11S,12R,16S)-14-(4-fluorophenyl)-9,9-dimethyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 98185922 |
| Molecular Formula | C21H19FN2O3S2 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (1S,2R,10R,11S,12R,16S)-14-(4-fluorophenyl)-9,9-dimethyl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | CC1(C)c2sc(=O)[nH]c2S[C@@H]2[C@H]3C[C@@H]([C@H]4C(=O)N(c5ccc(F)cc5)C(=O)[C@H]34)[C@@H]21 |
| InChI | InChI=1S/C21H19FN2O3S2/c1-21(2)14-10-7-11(15(14)28-17-16(21)29-20(27)23-17)13-12(10)18(25)24(19(13)26)9-5-3-8(22)4-6-9/h3-6,10-15H,7H2,1-2H3,(H,23,27)/t10-,11-,12+,13+,14-,15+/m0/s1 |
| InChIKey | AKMVJLNEUPAJMZ-JRULLXGZSA-N |
| XLogP | 3.40 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|