C24H23FN2O3S2 — CID 124711679
(1R,2S,10R,11S,12S,16S)-14-(4-fluorophenyl)spiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-6,13,15-trione (PubChem CID 124711679) has the molecular formula C24H23FN2O3S2 and a molecular weight of 470.59 g/mol. Its IUPAC name is (1R,2S,10R,11S,12S,16S)-14-(4-fluorophenyl)spiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-6,13,15-trione.
| Compound Name | (1R,2S,10R,11S,12S,16S)-14-(4-fluorophenyl)spiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-6,13,15-trione |
|---|---|
| PubChem CID | 124711679 |
| Molecular Formula | C24H23FN2O3S2 |
| Molecular Weight | 470.59 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (1R,2S,10R,11S,12S,16S)-14-(4-fluorophenyl)spiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-6,13,15-trione |
| SMILES | O=C1[C@@H]2[C@H]3C[C@@H]([C@@H]2C(=O)N1c1ccc(F)cc1)[C@H]1[C@H]3Sc2[nH]c(=O)sc2C12CCCCC2 |
| InChI | InChI=1S/C24H23FN2O3S2/c25-11-4-6-12(7-5-11)27-21(28)15-13-10-14(16(15)22(27)29)18-17(13)24(8-2-1-3-9-24)19-20(31-18)26-23(30)32-19/h4-7,13-18H,1-3,8-10H2,(H,26,30)/t13-,14+,15-,16+,17-,18-/m0/s1 |
| InChIKey | OWEJXHLHUPFABP-RFSXOUPVSA-N |
| XLogP | 4.32 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.59 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|