C22H26N2O5S2 — CID 43842499
4-(6,13,15-trioxospiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-14-yl)butanoic acid (PubChem CID 43842499) has the molecular formula C22H26N2O5S2 and a molecular weight of 462.59 g/mol. Its IUPAC name is 4-(6,13,15-trioxospiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-14-yl)butanoic acid.
| Compound Name | 4-(6,13,15-trioxospiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-14-yl)butanoic acid |
|---|---|
| PubChem CID | 43842499 |
| Molecular Formula | C22H26N2O5S2 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 4-(6,13,15-trioxospiro[3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-9,1'-cyclohexane]-14-yl)butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C2C3CC(C2C1=O)C1C3Sc2[nH]c(=O)sc2C12CCCCC2 |
| InChI | InChI=1S/C22H26N2O5S2/c25-12(26)5-4-8-24-19(27)13-10-9-11(14(13)20(24)28)16-15(10)22(6-2-1-3-7-22)17-18(30-16)23-21(29)31-17/h10-11,13-16H,1-9H2,(H,23,29)(H,25,26) |
| InChIKey | MVYUPMVLFWOTID-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|