C26H23N3O5S2 — CID 19250220
2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-methylphenyl)acetamide (PubChem CID 19250220) has the molecular formula C26H23N3O5S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is 2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 19250220 |
| Molecular Formula | C26H23N3O5S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | 2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)C3C4CC(C3C2=O)C2C(c3ccco3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C26H23N3O5S2/c1-11-4-6-12(7-5-11)27-16(30)10-29-24(31)18-13-9-14(19(18)25(29)32)21-17(13)20(15-3-2-8-34-15)22-23(35-21)28-26(33)36-22/h2-8,13-14,17-21H,9-10H2,1H3,(H,27,30)(H,28,33) |
| InChIKey | JPQZTRPSNXEKTB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|