C22H22N2O6S2 — CID 19252154
2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 19252154) has the molecular formula C22H22N2O6S2 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19252154 |
| Molecular Formula | C22H22N2O6S2 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 2-[(9S)-9-(furan-2-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | CC(C)C(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2ccco2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C22H22N2O6S2/c1-7(2)15(21(27)28)24-19(25)12-8-6-9(13(12)20(24)26)16-11(8)14(10-4-3-5-30-10)17-18(31-16)23-22(29)32-17/h3-5,7-9,11-16H,6H2,1-2H3,(H,23,29)(H,27,28) |
| InChIKey | ZNYYKJXYDDIFDW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 120.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|