C28H26N4O7S3 — CID 16557901
2-[9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 16557901) has the molecular formula C28H26N4O7S3 and a molecular weight of 626.74 g/mol. Its IUPAC name is 2-[9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 16557901 |
| Molecular Formula | C28H26N4O7S3 |
| Molecular Weight | 626.74 g/mol |
| Exact Mass | 626.10 |
| IUPAC Name | 2-[9-(4-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1ccc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CC(=O)Nc6ccc(S(N)(=O)=O)cc6)C(=O)C45)C23)cc1 |
| InChI | InChI=1S/C28H26N4O7S3/c1-39-14-6-2-12(3-7-14)19-20-16-10-17(23(20)40-25-24(19)41-28(36)31-25)22-21(16)26(34)32(27(22)35)11-18(33)30-13-4-8-15(9-5-13)42(29,37)38/h2-9,16-17,19-23H,10-11H2,1H3,(H,30,33)(H,31,36)(H2,29,37,38) |
| InChIKey | UGOMIOZCDHSHGO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 168.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.74 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|