C28H25N3O5S2 — CID 19250188
2-[(9S)-9-(2-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide (PubChem CID 19250188) has the molecular formula C28H25N3O5S2 and a molecular weight of 547.66 g/mol. Its IUPAC name is 2-[(9S)-9-(2-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide.
| Compound Name | 2-[(9S)-9-(2-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 19250188 |
| Molecular Formula | C28H25N3O5S2 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | 2-[(9S)-9-(2-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-N-phenylacetamide |
| SMILES | COc1ccccc1C1c2sc(=O)[nH]c2SC2C3CC(C4C(=O)N(CC(=O)Nc5ccccc5)C(=O)C34)C12 |
| InChI | InChI=1S/C28H25N3O5S2/c1-36-17-10-6-5-9-14(17)19-20-15-11-16(23(20)37-25-24(19)38-28(35)30-25)22-21(15)26(33)31(27(22)34)12-18(32)29-13-7-3-2-4-8-13/h2-10,15-16,19-23H,11-12H2,1H3,(H,29,32)(H,30,35) |
| InChIKey | AKTLBSQZWDMIIX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|