C22H20N2O5S2 — CID 99733945
2-[(1R,2R,9S,10R,11S,12S,16R)-9-(2-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid (PubChem CID 99733945) has the molecular formula C22H20N2O5S2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 2-[(1R,2R,9S,10R,11S,12S,16R)-9-(2-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid.
| Compound Name | 2-[(1R,2R,9S,10R,11S,12S,16R)-9-(2-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
|---|---|
| PubChem CID | 99733945 |
| Molecular Formula | C22H20N2O5S2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 2-[(1R,2R,9S,10R,11S,12S,16R)-9-(2-methylphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
| SMILES | Cc1ccccc1[C@H]1c2sc(=O)[nH]c2S[C@@H]2[C@@H]3C[C@@H]([C@@H]4C(=O)N(CC(=O)O)C(=O)[C@@H]34)[C@H]12 |
| InChI | InChI=1S/C22H20N2O5S2/c1-8-4-2-3-5-9(8)13-14-10-6-11(17(14)30-19-18(13)31-22(29)23-19)16-15(10)20(27)24(21(16)28)7-12(25)26/h2-5,10-11,13-17H,6-7H2,1H3,(H,23,29)(H,25,26)/t10-,11-,13-,14-,15+,16+,17-/m1/s1 |
| InChIKey | FBFLAKLJZPCBTA-ROCDRTMFSA-N |
| XLogP | 2.30 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|