C23H19N3O5S2 — CID 124762623
2-[(1R,2S,9S,10R,11S,12S,16S)-9-(1H-indol-3-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid (PubChem CID 124762623) has the molecular formula C23H19N3O5S2 and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-[(1R,2S,9S,10R,11S,12S,16S)-9-(1H-indol-3-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid.
| Compound Name | 2-[(1R,2S,9S,10R,11S,12S,16S)-9-(1H-indol-3-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
|---|---|
| PubChem CID | 124762623 |
| Molecular Formula | C23H19N3O5S2 |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 2-[(1R,2S,9S,10R,11S,12S,16S)-9-(1H-indol-3-yl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@@H](c2c[nH]c4ccccc24)c2sc(=O)[nH]c2S[C@@H]31 |
| InChI | InChI=1S/C23H19N3O5S2/c27-13(28)7-26-21(29)16-9-5-10(17(16)22(26)30)18-14(9)15(19-20(32-18)25-23(31)33-19)11-6-24-12-4-2-1-3-8(11)12/h1-4,6,9-10,14-18,24H,5,7H2,(H,25,31)(H,27,28)/t9-,10-,14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | CXVLMUPQMVXGBU-GUAUEGQFSA-N |
| XLogP | 2.48 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|