C31H26F3N3O7S2 — CID 19255526
3-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 19255526) has the molecular formula C31H26F3N3O7S2 and a molecular weight of 673.69 g/mol. Its IUPAC name is 3-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 3-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 19255526 |
| Molecular Formula | C31H26F3N3O7S2 |
| Molecular Weight | 673.69 g/mol |
| Exact Mass | 673.12 |
| IUPAC Name | 3-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)C2C3CC(C2C1=O)C1C(c2ccccc2OCC(=O)Nc2ccccc2C(F)(F)F)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C31H26F3N3O7S2/c32-31(33,34)16-6-2-3-7-17(16)35-19(38)12-44-18-8-4-1-5-13(18)21-22-14-11-15(25(22)45-27-26(21)46-30(43)36-27)24-23(14)28(41)37(29(24)42)10-9-20(39)40/h1-8,14-15,21-25H,9-12H2,(H,35,38)(H,36,43)(H,39,40) |
| InChIKey | CCOVVJAPAZPGLF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|