C32H28F3N3O7S2 — CID 19255652
4-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid (PubChem CID 19255652) has the molecular formula C32H28F3N3O7S2 and a molecular weight of 687.72 g/mol. Its IUPAC name is 4-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid.
| Compound Name | 4-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
|---|---|
| PubChem CID | 19255652 |
| Molecular Formula | C32H28F3N3O7S2 |
| Molecular Weight | 687.72 g/mol |
| Exact Mass | 687.13 |
| IUPAC Name | 4-[(9S)-6,13,15-trioxo-9-[2-[2-oxo-2-[2-(trifluoromethyl)anilino]ethoxy]phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]butanoic acid |
| SMILES | O=C(O)CCCN1C(=O)C2C3CC(C2C1=O)C1C(c2ccccc2OCC(=O)Nc2ccccc2C(F)(F)F)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C32H28F3N3O7S2/c33-32(34,35)17-7-2-3-8-18(17)36-20(39)13-45-19-9-4-1-6-14(19)22-23-15-12-16(26(23)46-28-27(22)47-31(44)37-28)25-24(15)29(42)38(30(25)43)11-5-10-21(40)41/h1-4,6-9,15-16,22-26H,5,10-13H2,(H,36,39)(H,37,44)(H,40,41) |
| InChIKey | QTOLIHCXMVWFFB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.72 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|