C36H31N3O8S2 — CID 78579248
ethyl 4-[(9S)-9-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 78579248) has the molecular formula C36H31N3O8S2 and a molecular weight of 697.79 g/mol. Its IUPAC name is ethyl 4-[(9S)-9-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(9S)-9-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 78579248 |
| Molecular Formula | C36H31N3O8S2 |
| Molecular Weight | 697.79 g/mol |
| Exact Mass | 697.16 |
| IUPAC Name | ethyl 4-[(9S)-9-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C4CC(C3C2=O)C2C(c3cc([N+](=O)[O-])ccc3OCc3cccc(C)c3)c3sc(=O)[nH]c3SC42)cc1 |
| InChI | InChI=1S/C36H31N3O8S2/c1-3-46-35(42)19-7-9-20(10-8-19)38-33(40)28-23-15-24(29(28)34(38)41)30-27(23)26(31-32(48-30)37-36(43)49-31)22-14-21(39(44)45)11-12-25(22)47-16-18-6-4-5-17(2)13-18/h4-14,23-24,26-30H,3,15-16H2,1-2H3,(H,37,43) |
| InChIKey | CUCUFEDEZONRQL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|