C31H25N3O8S2 — CID 78578643
ethyl 4-[(8S)-8-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate (PubChem CID 78578643) has the molecular formula C31H25N3O8S2 and a molecular weight of 631.69 g/mol. Its IUPAC name is ethyl 4-[(8S)-8-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate.
| Compound Name | ethyl 4-[(8S)-8-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
|---|---|
| PubChem CID | 78578643 |
| Molecular Formula | C31H25N3O8S2 |
| Molecular Weight | 631.69 g/mol |
| Exact Mass | 631.11 |
| IUPAC Name | ethyl 4-[(8S)-8-[2-[(3-methylphenyl)methoxy]-5-nitrophenyl]-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-11-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3Sc4[nH]c(=O)sc4[C@H](c4cc([N+](=O)[O-])ccc4OCc4cccc(C)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C31H25N3O8S2/c1-3-41-30(37)18-7-9-19(10-8-18)33-28(35)24-23(25-27(32-31(38)44-25)43-26(24)29(33)36)21-14-20(34(39)40)11-12-22(21)42-15-17-6-4-5-16(2)13-17/h4-14,23-24,26H,3,15H2,1-2H3,(H,32,38)/t23-,24?,26?/m1/s1 |
| InChIKey | WJFBNERSDSIVBO-LPXOAACNSA-N |
| XLogP | 5.20 |
| TPSA | 148.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.69 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|