C27H18ClN3O6S2 — CID 19251669
(1R,8R,9R)-8-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19251669) has the molecular formula C27H18ClN3O6S2 and a molecular weight of 580.04 g/mol. Its IUPAC name is (1R,8R,9R)-8-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-8-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19251669 |
| Molecular Formula | C27H18ClN3O6S2 |
| Molecular Weight | 580.04 g/mol |
| Exact Mass | 579.03 |
| IUPAC Name | (1R,8R,9R)-8-[2-[(3-chlorophenyl)methoxy]-5-nitrophenyl]-11-phenyl-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C1[C@H]2[C@H](c3cc([N+](=O)[O-])ccc3OCc3cccc(Cl)c3)c3sc(=O)[nH]c3S[C@H]2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C27H18ClN3O6S2/c28-15-6-4-5-14(11-15)13-37-19-10-9-17(31(35)36)12-18(19)20-21-23(38-24-22(20)39-27(34)29-24)26(33)30(25(21)32)16-7-2-1-3-8-16/h1-12,20-21,23H,13H2,(H,29,34)/t20-,21-,23+/m0/s1 |
| InChIKey | CHBFRBYNOLVXTF-QNWVGRARSA-N |
| XLogP | 5.37 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.04 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|