C35H28BrClN2O6S2 — CID 43849403
ethyl 4-[(1R,11S)-9-[5-bromo-2-[(3-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate (PubChem CID 43849403) has the molecular formula C35H28BrClN2O6S2 and a molecular weight of 752.11 g/mol. Its IUPAC name is ethyl 4-[(1R,11S)-9-[5-bromo-2-[(3-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate.
| Compound Name | ethyl 4-[(1R,11S)-9-[5-bromo-2-[(3-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
|---|---|
| PubChem CID | 43849403 |
| Molecular Formula | C35H28BrClN2O6S2 |
| Molecular Weight | 752.11 g/mol |
| Exact Mass | 750.03 |
| IUPAC Name | ethyl 4-[(1R,11S)-9-[5-bromo-2-[(3-chlorophenyl)methoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C3C(C2=O)[C@@H]2C[C@H]3C3Sc4[nH]c(=O)sc4C(c4cc(Br)ccc4OCc4cccc(Cl)c4)C32)cc1 |
| InChI | InChI=1S/C35H28BrClN2O6S2/c1-2-44-34(42)17-6-9-20(10-7-17)39-32(40)27-22-14-23(28(27)33(39)41)29-26(22)25(30-31(46-29)38-35(43)47-30)21-13-18(36)8-11-24(21)45-15-16-4-3-5-19(37)12-16/h3-13,22-23,25-29H,2,14-15H2,1H3,(H,38,43)/t22-,23-,25?,26?,27?,28?,29?/m1/s1 |
| InChIKey | GSTAPEUFKYUCKQ-OJSUNVOQSA-N |
| XLogP | 7.29 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.11 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|