C21H20N2O5S3 — CID 16557962
ethyl 2-(6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetate (PubChem CID 16557962) has the molecular formula C21H20N2O5S3 and a molecular weight of 476.60 g/mol. Its IUPAC name is ethyl 2-(6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetate.
| Compound Name | ethyl 2-(6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetate |
|---|---|
| PubChem CID | 16557962 |
| Molecular Formula | C21H20N2O5S3 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | ethyl 2-(6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C3CC(C2C1=O)C1C(c2cccs2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C21H20N2O5S3/c1-2-28-11(24)7-23-19(25)13-8-6-9(14(13)20(23)26)16-12(8)15(10-4-3-5-29-10)17-18(30-16)22-21(27)31-17/h3-5,8-9,12-16H,2,6-7H2,1H3,(H,22,27) |
| InChIKey | WAVVITOPDAGJBQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|