C23H24N2O5S3 — CID 124767107
6-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid (PubChem CID 124767107) has the molecular formula C23H24N2O5S3 and a molecular weight of 504.66 g/mol. Its IUPAC name is 6-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid.
| Compound Name | 6-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
|---|---|
| PubChem CID | 124767107 |
| Molecular Formula | C23H24N2O5S3 |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 6-[(1R,2R,9R,10R,11S,12S,16S)-6,13,15-trioxo-9-thiophen-2-yl-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1C(=O)[C@@H]2[C@H]3C[C@@H]([C@@H]2C1=O)[C@@H]1[C@H](c2cccs2)c2sc(=O)[nH]c2S[C@H]31 |
| InChI | InChI=1S/C23H24N2O5S3/c26-13(27)6-2-1-3-7-25-21(28)15-10-9-11(16(15)22(25)29)18-14(10)17(12-5-4-8-31-12)19-20(32-18)24-23(30)33-19/h4-5,8,10-11,14-18H,1-3,6-7,9H2,(H,24,30)(H,26,27)/t10-,11-,14-,15+,16-,17+,18-/m1/s1 |
| InChIKey | UECRIQBKZVVKJB-BLBDEYJDSA-N |
| XLogP | 3.62 |
| TPSA | 107.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|