C25H18ClFN2O2S3 — CID 18865827
9-(4-chlorophenyl)-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione (PubChem CID 18865827) has the molecular formula C25H18ClFN2O2S3 and a molecular weight of 529.08 g/mol. Its IUPAC name is 9-(4-chlorophenyl)-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione.
| Compound Name | 9-(4-chlorophenyl)-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
|---|---|
| PubChem CID | 18865827 |
| Molecular Formula | C25H18ClFN2O2S3 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 528.02 |
| IUPAC Name | 9-(4-chlorophenyl)-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
| SMILES | O=C1C2C3CC(C2C(=O)N1c1ccc(F)cc1)C1C(c2ccc(Cl)cc2)c2sc(=S)[nH]c2SC31 |
| InChI | InChI=1S/C25H18ClFN2O2S3/c26-11-3-1-10(2-4-11)16-17-14-9-15(20(17)33-22-21(16)34-25(32)28-22)19-18(14)23(30)29(24(19)31)13-7-5-12(27)6-8-13/h1-8,14-20H,9H2,(H,28,32) |
| InChIKey | CNQINZHTTOBYDD-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|