C25H18ClN3O5S2 — CID 19250704
(1R,2R,9R,10S,11S,12S,16R)-9-(4-chlorophenyl)-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 19250704) has the molecular formula C25H18ClN3O5S2 and a molecular weight of 540.02 g/mol. Its IUPAC name is (1R,2R,9R,10S,11S,12S,16R)-9-(4-chlorophenyl)-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2R,9R,10S,11S,12S,16R)-9-(4-chlorophenyl)-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 19250704 |
| Molecular Formula | C25H18ClN3O5S2 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.04 |
| IUPAC Name | (1R,2R,9R,10S,11S,12S,16R)-9-(4-chlorophenyl)-14-(4-nitrophenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1[C@H]2[C@H]3C[C@@H]([C@@H]2C(=O)N1c1ccc([N+](=O)[O-])cc1)[C@H]1[C@H](c2ccc(Cl)cc2)c2sc(=O)[nH]c2S[C@H]31 |
| InChI | InChI=1S/C25H18ClN3O5S2/c26-11-3-1-10(2-4-11)16-17-14-9-15(20(17)35-22-21(16)36-25(32)27-22)19-18(14)23(30)28(24(19)31)12-5-7-13(8-6-12)29(33)34/h1-8,14-20H,9H2,(H,27,32)/t14-,15-,16+,17+,18+,19+,20-/m1/s1 |
| InChIKey | DJDDCFFQNPOUNR-LFGUEBOJSA-N |
| XLogP | 4.68 |
| TPSA | 113.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|