C32H25N3O6S2 — CID 19250732
(1R,2R,9R,10S,11S,12S,16R)-14-(4-nitrophenyl)-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 19250732) has the molecular formula C32H25N3O6S2 and a molecular weight of 611.70 g/mol. Its IUPAC name is (1R,2R,9R,10S,11S,12S,16R)-14-(4-nitrophenyl)-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2R,9R,10S,11S,12S,16R)-14-(4-nitrophenyl)-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 19250732 |
| Molecular Formula | C32H25N3O6S2 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.12 |
| IUPAC Name | (1R,2R,9R,10S,11S,12S,16R)-14-(4-nitrophenyl)-9-(4-phenylmethoxyphenyl)-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1[C@H]2[C@H]3C[C@@H]([C@@H]2C(=O)N1c1ccc([N+](=O)[O-])cc1)[C@H]1[C@H](c2ccc(OCc4ccccc4)cc2)c2sc(=O)[nH]c2S[C@H]31 |
| InChI | InChI=1S/C32H25N3O6S2/c36-30-25-21-14-22(26(25)31(37)34(30)18-8-10-19(11-9-18)35(39)40)27-24(21)23(28-29(42-27)33-32(38)43-28)17-6-12-20(13-7-17)41-15-16-4-2-1-3-5-16/h1-13,21-27H,14-15H2,(H,33,38)/t21-,22-,23+,24+,25+,26+,27-/m1/s1 |
| InChIKey | UILKUENELRRIRX-LHPGEAEKSA-N |
| XLogP | 5.60 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|