C33H25Cl2FN2O4S3 — CID 18865835
9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione (PubChem CID 18865835) has the molecular formula C33H25Cl2FN2O4S3 and a molecular weight of 699.68 g/mol. Its IUPAC name is 9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione.
| Compound Name | 9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
|---|---|
| PubChem CID | 18865835 |
| Molecular Formula | C33H25Cl2FN2O4S3 |
| Molecular Weight | 699.68 g/mol |
| Exact Mass | 698.03 |
| IUPAC Name | 9-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]-14-(4-fluorophenyl)-6-sulfanylidene-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
| SMILES | COc1cc(C2c3sc(=S)[nH]c3SC3C4CC(C5C(=O)N(c6ccc(F)cc6)C(=O)C45)C23)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H25Cl2FN2O4S3/c1-41-23-10-14(3-9-22(23)42-13-15-2-4-16(34)11-21(15)35)24-25-19-12-20(28(25)44-30-29(24)45-33(43)37-30)27-26(19)31(39)38(32(27)40)18-7-5-17(36)6-8-18/h2-11,19-20,24-28H,12-13H2,1H3,(H,37,43) |
| InChIKey | JSPOLECLADWHMI-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.68 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|