C20H17NO4S3 — CID 18865727
9-(4-methoxyphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione (PubChem CID 18865727) has the molecular formula C20H17NO4S3 and a molecular weight of 431.56 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione.
| Compound Name | 9-(4-methoxyphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
|---|---|
| PubChem CID | 18865727 |
| Molecular Formula | C20H17NO4S3 |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.03 |
| IUPAC Name | 9-(4-methoxyphenyl)-6-sulfanylidene-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-13,15-dione |
| SMILES | COc1ccc(C2c3sc(=S)[nH]c3SC3C4CC(C5C(=O)OC(=O)C45)C23)cc1 |
| InChI | InChI=1S/C20H17NO4S3/c1-24-8-4-2-7(3-5-8)11-12-9-6-10(14-13(9)18(22)25-19(14)23)15(12)27-17-16(11)28-20(26)21-17/h2-5,9-15H,6H2,1H3,(H,21,26) |
| InChIKey | OHFNXAJMGZKVIS-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|