C23H22N2O7S2 — CID 124831319
(2R)-2-[(1S,2R,9R,10R,11S,12S,16S)-9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 124831319) has the molecular formula C23H22N2O7S2 and a molecular weight of 502.57 g/mol. Its IUPAC name is (2R)-2-[(1S,2R,9R,10R,11S,12S,16S)-9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | (2R)-2-[(1S,2R,9R,10R,11S,12S,16S)-9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 124831319 |
| Molecular Formula | C23H22N2O7S2 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | (2R)-2-[(1S,2R,9R,10R,11S,12S,16S)-9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | COc1cc([C@@H]2c3sc(=O)[nH]c3S[C@@H]3[C@H]4C[C@@H]([C@@H]5C(=O)N([C@H](C)C(=O)O)C(=O)[C@H]45)[C@H]23)ccc1O |
| InChI | InChI=1S/C23H22N2O7S2/c1-7(22(29)30)25-20(27)15-9-6-10(16(15)21(25)28)17-14(9)13(18-19(33-17)24-23(31)34-18)8-3-4-11(26)12(5-8)32-2/h3-5,7,9-10,13-17,26H,6H2,1-2H3,(H,24,31)(H,29,30)/t7-,9-,10+,13+,14-,15+,16-,17-/m1/s1 |
| InChIKey | PZCVHTJSHJYMSA-JTKDAZMOSA-N |
| XLogP | 2.10 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|