C23H21N2O7S2- — CID 4621911
3-[9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate (PubChem CID 4621911) has the molecular formula C23H21N2O7S2- and a molecular weight of 501.56 g/mol. Its IUPAC name is 3-[9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate.
| Compound Name | 3-[9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate |
|---|---|
| PubChem CID | 4621911 |
| Molecular Formula | C23H21N2O7S2- |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 3-[9-(4-hydroxy-3-methoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoate |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CCC(=O)[O-])C(=O)C45)C23)ccc1O |
| InChI | InChI=1S/C23H22N2O7S2/c1-32-12-6-8(2-3-11(12)26)14-15-9-7-10(18(15)33-20-19(14)34-23(31)24-20)17-16(9)21(29)25(22(17)30)5-4-13(27)28/h2-3,6,9-10,14-18,26H,4-5,7H2,1H3,(H,24,31)(H,27,28)/p-1 |
| InChIKey | YAIVYBNOQIIQME-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|