C24H24N2O8S2 — CID 19251953
3-[(9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 19251953) has the molecular formula C24H24N2O8S2 and a molecular weight of 532.60 g/mol. Its IUPAC name is 3-[(9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 3-[(9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 19251953 |
| Molecular Formula | C24H24N2O8S2 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.10 |
| IUPAC Name | 3-[(9S)-9-(4-hydroxy-3,5-dimethoxyphenyl)-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(CCC(=O)O)C(=O)C45)C23)cc(OC)c1O |
| InChI | InChI=1S/C24H24N2O8S2/c1-33-11-5-8(6-12(34-2)18(11)29)14-15-9-7-10(19(15)35-21-20(14)36-24(32)25-21)17-16(9)22(30)26(23(17)31)4-3-13(27)28/h5-6,9-10,14-17,19,29H,3-4,7H2,1-2H3,(H,25,32)(H,27,28) |
| InChIKey | ROLCDTGTILUQPA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 146.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|