C34H29N3O7S2 — CID 19255352
2-[(9S)-9-[3-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid (PubChem CID 19255352) has the molecular formula C34H29N3O7S2 and a molecular weight of 655.75 g/mol. Its IUPAC name is 2-[(9S)-9-[3-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid.
| Compound Name | 2-[(9S)-9-[3-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
|---|---|
| PubChem CID | 19255352 |
| Molecular Formula | C34H29N3O7S2 |
| Molecular Weight | 655.75 g/mol |
| Exact Mass | 655.14 |
| IUPAC Name | 2-[(9S)-9-[3-[2-(naphthalen-2-ylamino)-2-oxoethoxy]phenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1C(=O)C2C3CC(C2C1=O)C1C(c2cccc(OCC(=O)Nc4ccc5ccccc5c4)c2)c2sc(=O)[nH]c2SC31 |
| InChI | InChI=1S/C34H29N3O7S2/c1-15(33(41)42)37-31(39)26-21-13-22(27(26)32(37)40)28-25(21)24(29-30(45-28)36-34(43)46-29)18-7-4-8-20(12-18)44-14-23(38)35-19-10-9-16-5-2-3-6-17(16)11-19/h2-12,15,21-22,24-28H,13-14H2,1H3,(H,35,38)(H,36,43)(H,41,42) |
| InChIKey | LFKYMZVIJDBTGS-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 145.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.75 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|