C32H30FN3O5S2 — CID 43851541
(1R,9S,11S)-14-(4-fluorophenyl)-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 43851541) has the molecular formula C32H30FN3O5S2 and a molecular weight of 619.74 g/mol. Its IUPAC name is (1R,9S,11S)-14-(4-fluorophenyl)-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,9S,11S)-14-(4-fluorophenyl)-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 43851541 |
| Molecular Formula | C32H30FN3O5S2 |
| Molecular Weight | 619.74 g/mol |
| Exact Mass | 619.16 |
| IUPAC Name | (1R,9S,11S)-14-(4-fluorophenyl)-9-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C(COc1cccc([C@H]2c3sc(=O)[nH]c3SC3C2[C@H]2C[C@@H]3C3C(=O)N(c4ccc(F)cc4)C(=O)C32)c1)N1CCCCC1 |
| InChI | InChI=1S/C32H30FN3O5S2/c33-17-7-9-18(10-8-17)36-30(38)25-20-14-21(26(25)31(36)39)27-24(20)23(28-29(42-27)34-32(40)43-28)16-5-4-6-19(13-16)41-15-22(37)35-11-2-1-3-12-35/h4-10,13,20-21,23-27H,1-3,11-12,14-15H2,(H,34,40)/t20-,21-,23-,24?,25?,26?,27?/m1/s1 |
| InChIKey | BNZSPIWEXRBPGY-YQZKFDTHSA-N |
| XLogP | 4.64 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|