C27H24ClN3O5S2 — CID 19254209
(1R,8R,9R)-11-(4-chlorophenyl)-8-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 19254209) has the molecular formula C27H24ClN3O5S2 and a molecular weight of 570.09 g/mol. Its IUPAC name is (1R,8R,9R)-11-(4-chlorophenyl)-8-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (1R,8R,9R)-11-(4-chlorophenyl)-8-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 19254209 |
| Molecular Formula | C27H24ClN3O5S2 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.08 |
| IUPAC Name | (1R,8R,9R)-11-(4-chlorophenyl)-8-[3-(2-oxo-2-piperidin-1-ylethoxy)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(COc1cccc([C@@H]2c3sc(=O)[nH]c3S[C@H]3C(=O)N(c4ccc(Cl)cc4)C(=O)[C@@H]23)c1)N1CCCCC1 |
| InChI | InChI=1S/C27H24ClN3O5S2/c28-16-7-9-17(10-8-16)31-25(33)21-20(22-24(29-27(35)38-22)37-23(21)26(31)34)15-5-4-6-18(13-15)36-14-19(32)30-11-2-1-3-12-30/h4-10,13,20-21,23H,1-3,11-12,14H2,(H,29,35)/t20-,21-,23+/m0/s1 |
| InChIKey | VIWBPUZLIVNVJP-QNWVGRARSA-N |
| XLogP | 4.28 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|