C33H33N3O9S2 — CID 19255869
2-[(9S)-9-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid (PubChem CID 19255869) has the molecular formula C33H33N3O9S2 and a molecular weight of 679.77 g/mol. Its IUPAC name is 2-[(9S)-9-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid.
| Compound Name | 2-[(9S)-9-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19255869 |
| Molecular Formula | C33H33N3O9S2 |
| Molecular Weight | 679.77 g/mol |
| Exact Mass | 679.17 |
| IUPAC Name | 2-[(9S)-9-[4-[2-(4-hydroxyanilino)-2-oxoethoxy]-3-methoxyphenyl]-6,13,15-trioxo-3,7-dithia-5,14-diazapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-en-14-yl]-3-methylbutanoic acid |
| SMILES | COc1cc(C2c3sc(=O)[nH]c3SC3C4CC(C5C(=O)N(C(C(=O)O)C(C)C)C(=O)C45)C23)ccc1OCC(=O)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C33H33N3O9S2/c1-13(2)26(32(41)42)36-30(39)24-17-11-18(25(24)31(36)40)27-23(17)22(28-29(46-27)35-33(43)47-28)14-4-9-19(20(10-14)44-3)45-12-21(38)34-15-5-7-16(37)8-6-15/h4-10,13,17-18,22-27,37H,11-12H2,1-3H3,(H,34,38)(H,35,43)(H,41,42) |
| InChIKey | QABVHDQDNKTWON-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 175.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.77 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|