C20H17NO6S2 — CID 98272795
(1R,2R,4R,5S,6S,15S,22R)-10-methoxy-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid (PubChem CID 98272795) has the molecular formula C20H17NO6S2 and a molecular weight of 431.49 g/mol. Its IUPAC name is (1R,2R,4R,5S,6S,15S,22R)-10-methoxy-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid.
| Compound Name | (1R,2R,4R,5S,6S,15S,22R)-10-methoxy-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid |
|---|---|
| PubChem CID | 98272795 |
| Molecular Formula | C20H17NO6S2 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | (1R,2R,4R,5S,6S,15S,22R)-10-methoxy-7,18-dioxo-8-oxa-17,21-dithia-19-azahexacyclo[13.7.0.02,6.04,22.09,14.016,20]docosa-9(14),10,12,16(20)-tetraene-5-carboxylic acid |
| SMILES | COc1cccc2c1OC(=O)[C@@H]1[C@@H]3C[C@H]([C@@H]4Sc5[nH]c(=O)sc5[C@H]2[C@H]34)[C@@H]1C(=O)O |
| InChI | InChI=1S/C20H17NO6S2/c1-26-9-4-2-3-6-10-11-7-5-8(15(11)28-17-16(10)29-20(25)21-17)12(18(22)23)13(7)19(24)27-14(6)9/h2-4,7-8,10-13,15H,5H2,1H3,(H,21,25)(H,22,23)/t7-,8+,10-,11+,12+,13-,15+/m1/s1 |
| InChIKey | LETQKJKEXLWDSX-YMGKNNFQSA-N |
| XLogP | 2.55 |
| TPSA | 105.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|