C19H13Br2NO5S2 — CID 124769381
(1R,2S,9S,10S,11R,12R,16R)-9-(3,5-dibromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 124769381) has the molecular formula C19H13Br2NO5S2 and a molecular weight of 559.26 g/mol. Its IUPAC name is (1R,2S,9S,10S,11R,12R,16R)-9-(3,5-dibromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2S,9S,10S,11R,12R,16R)-9-(3,5-dibromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 124769381 |
| Molecular Formula | C19H13Br2NO5S2 |
| Molecular Weight | 559.26 g/mol |
| Exact Mass | 556.86 |
| IUPAC Name | (1R,2S,9S,10S,11R,12R,16R)-9-(3,5-dibromo-2-hydroxyphenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]3C[C@H]([C@@H]12)[C@H]1[C@@H](c2cc(Br)cc(Br)c2O)c2sc(=O)[nH]c2S[C@@H]31 |
| InChI | InChI=1S/C19H13Br2NO5S2/c20-4-1-6(13(23)8(21)2-4)10-9-5-3-7(12-11(5)17(24)27-18(12)25)14(9)28-16-15(10)29-19(26)22-16/h1-2,5,7,9-12,14,23H,3H2,(H,22,26)/t5-,7+,9-,10+,11+,12-,14-/m0/s1 |
| InChIKey | SYWKMBWKEDYMJX-LGLZJOPZSA-N |
| XLogP | 3.85 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|