C19H11BrClNO3S2 — CID 124770788
(1R,10S,11R)-4-bromo-11-(4-chlorophenyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-9,15-dione (PubChem CID 124770788) has the molecular formula C19H11BrClNO3S2 and a molecular weight of 480.79 g/mol. Its IUPAC name is (1R,10S,11R)-4-bromo-11-(4-chlorophenyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-9,15-dione.
| Compound Name | (1R,10S,11R)-4-bromo-11-(4-chlorophenyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-9,15-dione |
|---|---|
| PubChem CID | 124770788 |
| Molecular Formula | C19H11BrClNO3S2 |
| Molecular Weight | 480.79 g/mol |
| Exact Mass | 478.91 |
| IUPAC Name | (1R,10S,11R)-4-bromo-11-(4-chlorophenyl)-8-oxa-12,16-dithia-14-azatetracyclo[8.7.0.02,7.013,17]heptadeca-2(7),3,5,13(17)-tetraene-9,15-dione |
| SMILES | O=C1Oc2ccc(Br)cc2[C@@H]2c3sc(=O)[nH]c3S[C@@H](c3ccc(Cl)cc3)[C@H]12 |
| InChI | InChI=1S/C19H11BrClNO3S2/c20-9-3-6-12-11(7-9)13-14(18(23)25-12)15(8-1-4-10(21)5-2-8)26-17-16(13)27-19(24)22-17/h1-7,13-15H,(H,22,24)/t13-,14+,15-/m0/s1 |
| InChIKey | GOJZXZLIRGABBS-ZNMIVQPWSA-N |
| XLogP | 5.37 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.79 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|