C26H21BrClN3O6S2 — CID 78580279
(8S)-8-[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-11-(4-chlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione (PubChem CID 78580279) has the molecular formula C26H21BrClN3O6S2 and a molecular weight of 650.96 g/mol. Its IUPAC name is (8S)-8-[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-11-(4-chlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione.
| Compound Name | (8S)-8-[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-11-(4-chlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
|---|---|
| PubChem CID | 78580279 |
| Molecular Formula | C26H21BrClN3O6S2 |
| Molecular Weight | 650.96 g/mol |
| Exact Mass | 648.97 |
| IUPAC Name | (8S)-8-[5-bromo-2-(2-morpholin-4-yl-2-oxoethoxy)phenyl]-11-(4-chlorophenyl)-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-ene-5,10,12-trione |
| SMILES | O=C(COc1ccc(Br)cc1[C@H]1c2sc(=O)[nH]c2SC2C(=O)N(c3ccc(Cl)cc3)C(=O)C21)N1CCOCC1 |
| InChI | InChI=1S/C26H21BrClN3O6S2/c27-13-1-6-17(37-12-18(32)30-7-9-36-10-8-30)16(11-13)19-20-22(38-23-21(19)39-26(35)29-23)25(34)31(24(20)33)15-4-2-14(28)3-5-15/h1-6,11,19-20,22H,7-10,12H2,(H,29,35)/t19-,20?,22?/m1/s1 |
| InChIKey | DQRHVGNHAZSIFC-VRKFHHGPSA-N |
| XLogP | 3.89 |
| TPSA | 109.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.96 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|