C24H18Cl2N2O6S2 — CID 78580990
ethyl 2-[4-chloro-2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate (PubChem CID 78580990) has the molecular formula C24H18Cl2N2O6S2 and a molecular weight of 565.46 g/mol. Its IUPAC name is ethyl 2-[4-chloro-2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate.
| Compound Name | ethyl 2-[4-chloro-2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
|---|---|
| PubChem CID | 78580990 |
| Molecular Formula | C24H18Cl2N2O6S2 |
| Molecular Weight | 565.46 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | ethyl 2-[4-chloro-2-[(8S)-11-(4-chlorophenyl)-5,10,12-trioxo-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Cl)cc1[C@H]1c2sc(=O)[nH]c2SC2C(=O)N(c3ccc(Cl)cc3)C(=O)C21 |
| InChI | InChI=1S/C24H18Cl2N2O6S2/c1-2-33-16(29)10-34-15-8-5-12(26)9-14(15)17-18-20(35-21-19(17)36-24(32)27-21)23(31)28(22(18)30)13-6-3-11(25)4-7-13/h3-9,17-18,20H,2,10H2,1H3,(H,27,32)/t17-,18?,20?/m1/s1 |
| InChIKey | XJGRPNFXKUWXBG-PGYGNJIDSA-N |
| XLogP | 4.48 |
| TPSA | 105.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|