C19H14N2O7S2 — CID 124769342
(1R,2S,9S,10S,11R,12R,16R)-9-(2-hydroxy-5-nitrophenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione (PubChem CID 124769342) has the molecular formula C19H14N2O7S2 and a molecular weight of 446.46 g/mol. Its IUPAC name is (1R,2S,9S,10S,11R,12R,16R)-9-(2-hydroxy-5-nitrophenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione.
| Compound Name | (1R,2S,9S,10S,11R,12R,16R)-9-(2-hydroxy-5-nitrophenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
|---|---|
| PubChem CID | 124769342 |
| Molecular Formula | C19H14N2O7S2 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | (1R,2S,9S,10S,11R,12R,16R)-9-(2-hydroxy-5-nitrophenyl)-14-oxa-3,7-dithia-5-azapentacyclo[9.5.1.02,10.04,8.012,16]heptadec-4(8)-ene-6,13,15-trione |
| SMILES | O=C1OC(=O)[C@H]2[C@H]3C[C@H]([C@@H]12)[C@H]1[C@@H](c2cc([N+](=O)[O-])ccc2O)c2sc(=O)[nH]c2S[C@@H]31 |
| InChI | InChI=1S/C19H14N2O7S2/c22-9-2-1-5(21(26)27)3-6(9)10-11-7-4-8(13-12(7)17(23)28-18(13)24)14(11)29-16-15(10)30-19(25)20-16/h1-3,7-8,10-14,22H,4H2,(H,20,25)/t7-,8+,10+,11-,12+,13-,14-/m0/s1 |
| InChIKey | QXNADULDDZGURB-LINFNCPDSA-N |
| XLogP | 2.24 |
| TPSA | 139.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|