C16H14N2O8S2 — CID 124767380
dimethyl (5R,6S,7R)-7-(2-hydroxy-5-nitrophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate (PubChem CID 124767380) has the molecular formula C16H14N2O8S2 and a molecular weight of 426.43 g/mol. Its IUPAC name is dimethyl (5R,6S,7R)-7-(2-hydroxy-5-nitrophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate.
| Compound Name | dimethyl (5R,6S,7R)-7-(2-hydroxy-5-nitrophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 124767380 |
| Molecular Formula | C16H14N2O8S2 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | dimethyl (5R,6S,7R)-7-(2-hydroxy-5-nitrophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](c2cc([N+](=O)[O-])ccc2O)c2sc(=O)[nH]c2S[C@H]1C(=O)OC |
| InChI | InChI=1S/C16H14N2O8S2/c1-25-14(20)10-9(7-5-6(18(23)24)3-4-8(7)19)11-13(17-16(22)28-11)27-12(10)15(21)26-2/h3-5,9-10,12,19H,1-2H3,(H,17,22)/t9-,10+,12+/m0/s1 |
| InChIKey | KEVXQYVXTVVSMH-HOSYDEDBSA-N |
| XLogP | 1.62 |
| TPSA | 148.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|