C18H18ClNO5S2 — CID 124711209
diethyl (5R,6S,7R)-7-(4-chlorophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate (PubChem CID 124711209) has the molecular formula C18H18ClNO5S2 and a molecular weight of 427.93 g/mol. Its IUPAC name is diethyl (5R,6S,7R)-7-(4-chlorophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate.
| Compound Name | diethyl (5R,6S,7R)-7-(4-chlorophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
|---|---|
| PubChem CID | 124711209 |
| Molecular Formula | C18H18ClNO5S2 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | diethyl (5R,6S,7R)-7-(4-chlorophenyl)-2-oxo-3,5,6,7-tetrahydrothiopyrano[2,3-d][1,3]thiazole-5,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccc(Cl)cc2)c2sc(=O)[nH]c2S[C@H]1C(=O)OCC |
| InChI | InChI=1S/C18H18ClNO5S2/c1-3-24-16(21)12-11(9-5-7-10(19)8-6-9)13-15(20-18(23)27-13)26-14(12)17(22)25-4-2/h5-8,11-12,14H,3-4H2,1-2H3,(H,20,23)/t11-,12+,14+/m0/s1 |
| InChIKey | HFMIUQYLOXFQDO-OUCADQQQSA-N |
| XLogP | 3.44 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'} |
|---|